C23H28F5N — CID 141039661
N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)-2-phenylaniline (PubChem CID 141039661) has the molecular formula C23H28F5N and a molecular weight of 413.47 g/mol. Its IUPAC name is N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)-2-phenylaniline.
| Compound Name | N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)-2-phenylaniline |
|---|---|
| PubChem CID | 141039661 |
| Molecular Formula | C23H28F5N |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)-2-phenylaniline |
| SMILES | CCCCCCCCCN(c1ccccc1-c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H28F5N/c1-2-3-4-5-6-7-13-18-29(23(27,28)22(24,25)26)21-17-12-11-16-20(21)19-14-9-8-10-15-19/h8-12,14-17H,2-7,13,18H2,1H3 |
| InChIKey | SGQWLQDOKXUVNL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|