C18H17F14N — CID 22637868
2,4,5-trifluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-methyl-3-(1,1,2,2,2-pentafluoroethyl)aniline (PubChem CID 22637868) has the molecular formula C18H17F14N and a molecular weight of 513.31 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-methyl-3-(1,1,2,2,2-pentafluoroethyl)aniline.
| Compound Name | 2,4,5-trifluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-methyl-3-(1,1,2,2,2-pentafluoroethyl)aniline |
|---|---|
| PubChem CID | 22637868 |
| Molecular Formula | C18H17F14N |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2,4,5-trifluoro-N-(1,1,2,2,3,3-hexafluorononyl)-N-methyl-3-(1,1,2,2,2-pentafluoroethyl)aniline |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)N(C)c1cc(F)c(F)c(C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C18H17F14N/c1-3-4-5-6-7-14(22,23)16(26,27)18(31,32)33(2)10-8-9(19)12(20)11(13(10)21)15(24,25)17(28,29)30/h8H,3-7H2,1-2H3 |
| InChIKey | ALWNXBNKUCECAM-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|