C15H17F8N — CID 22637791
2,4,5-trifluoro-N-methyl-N-(2-methylpentyl)-3-(1,1,2,2,2-pentafluoroethyl)aniline (PubChem CID 22637791) has the molecular formula C15H17F8N and a molecular weight of 363.29 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-methyl-N-(2-methylpentyl)-3-(1,1,2,2,2-pentafluoroethyl)aniline.
| Compound Name | 2,4,5-trifluoro-N-methyl-N-(2-methylpentyl)-3-(1,1,2,2,2-pentafluoroethyl)aniline |
|---|---|
| PubChem CID | 22637791 |
| Molecular Formula | C15H17F8N |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2,4,5-trifluoro-N-methyl-N-(2-methylpentyl)-3-(1,1,2,2,2-pentafluoroethyl)aniline |
| SMILES | CCCC(C)CN(C)c1cc(F)c(F)c(C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C15H17F8N/c1-4-5-8(2)7-24(3)10-6-9(16)12(17)11(13(10)18)14(19,20)15(21,22)23/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | NOMDHGRLIUACRU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|