C15H14F11N — CID 22638145
2,4,5-trifluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)aniline (PubChem CID 22638145) has the molecular formula C15H14F11N and a molecular weight of 417.26 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)aniline.
| Compound Name | 2,4,5-trifluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 22638145 |
| Molecular Formula | C15H14F11N |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2,4,5-trifluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)aniline |
| SMILES | CCCC(C)CN(c1cc(F)c(F)c(C(F)(F)F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F11N/c1-3-4-7(2)6-27(15(25,26)14(22,23)24)9-5-8(16)11(17)10(12(9)18)13(19,20)21/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | LYPJHXRKUOLNBJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|