C9H8F5N — CID 167292102
3-ethyl-2,5-difluoro-4-(trifluoromethyl)aniline (PubChem CID 167292102) has the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. Its IUPAC name is 3-ethyl-2,5-difluoro-4-(trifluoromethyl)aniline.
| Compound Name | 3-ethyl-2,5-difluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167292102 |
| Molecular Formula | C9H8F5N |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-ethyl-2,5-difluoro-4-(trifluoromethyl)aniline |
| SMILES | CCc1c(F)c(N)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C9H8F5N/c1-2-4-7(9(12,13)14)5(10)3-6(15)8(4)11/h3H,2,15H2,1H3 |
| InChIKey | BNIICHJWNWKZCG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|