C11H15F3N2 — CID 150498422
3,5-diethyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 150498422) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 3,5-diethyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 3,5-diethyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 150498422 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3,5-diethyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCc1cc(N)c(C(F)(F)F)c(CC)c1N |
| InChI | InChI=1S/C11H15F3N2/c1-3-6-5-8(15)9(11(12,13)14)7(4-2)10(6)16/h5H,3-4,15-16H2,1-2H3 |
| InChIKey | HXHDQJUHULPYBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|