C12H19NS — CID 134347256
2-amino-3,4,5-triethylbenzenethiol (PubChem CID 134347256) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 2-amino-3,4,5-triethylbenzenethiol.
| Compound Name | 2-amino-3,4,5-triethylbenzenethiol |
|---|---|
| PubChem CID | 134347256 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-amino-3,4,5-triethylbenzenethiol |
| SMILES | CCc1cc(S)c(N)c(CC)c1CC |
| InChI | InChI=1S/C12H19NS/c1-4-8-7-11(14)12(13)10(6-3)9(8)5-2/h7,14H,4-6,13H2,1-3H3 |
| InChIKey | VRMRPRPUALJQJA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|