C10H16N2S — CID 150249754
2,4-diamino-3,5-diethylbenzenethiol (PubChem CID 150249754) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 2,4-diamino-3,5-diethylbenzenethiol.
| Compound Name | 2,4-diamino-3,5-diethylbenzenethiol |
|---|---|
| PubChem CID | 150249754 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2,4-diamino-3,5-diethylbenzenethiol |
| SMILES | CCc1cc(S)c(N)c(CC)c1N |
| InChI | InChI=1S/C10H16N2S/c1-3-6-5-8(13)10(12)7(4-2)9(6)11/h5,13H,3-4,11-12H2,1-2H3 |
| InChIKey | FZHACMTXNKWJDT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|