C33H48N4 — CID 87865367
5-[bis(4-amino-3,5-diethylphenyl)methyl]-2,4,6-triethylbenzene-1,3-diamine (PubChem CID 87865367) has the molecular formula C33H48N4 and a molecular weight of 500.78 g/mol. Its IUPAC name is 5-[bis(4-amino-3,5-diethylphenyl)methyl]-2,4,6-triethylbenzene-1,3-diamine.
| Compound Name | 5-[bis(4-amino-3,5-diethylphenyl)methyl]-2,4,6-triethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 87865367 |
| Molecular Formula | C33H48N4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | 5-[bis(4-amino-3,5-diethylphenyl)methyl]-2,4,6-triethylbenzene-1,3-diamine |
| SMILES | CCc1cc(C(c2cc(CC)c(N)c(CC)c2)c2c(CC)c(N)c(CC)c(N)c2CC)cc(CC)c1N |
| InChI | InChI=1S/C33H48N4/c1-8-19-15-23(16-20(9-2)30(19)34)28(24-17-21(10-3)31(35)22(11-4)18-24)29-25(12-5)32(36)27(14-7)33(37)26(29)13-6/h15-18,28H,8-14,34-37H2,1-7H3 |
| InChIKey | FPRNDZSROGYJTQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|