C9H14N2S2 — CID 123643667
4,6-diamino-5-ethyl-2-methylbenzene-1,3-dithiol (PubChem CID 123643667) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 4,6-diamino-5-ethyl-2-methylbenzene-1,3-dithiol.
| Compound Name | 4,6-diamino-5-ethyl-2-methylbenzene-1,3-dithiol |
|---|---|
| PubChem CID | 123643667 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4,6-diamino-5-ethyl-2-methylbenzene-1,3-dithiol |
| SMILES | CCc1c(N)c(S)c(C)c(S)c1N |
| InChI | InChI=1S/C9H14N2S2/c1-3-5-6(10)8(12)4(2)9(13)7(5)11/h12-13H,3,10-11H2,1-2H3 |
| InChIKey | JQZSLVGTJHAETH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|