C24H34 — CID 20685020
1-ethyl-2,3,5,6-tetramethyl-4-[(2,3,4,5,6-pentamethylphenyl)methyl]benzene (PubChem CID 20685020) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-ethyl-2,3,5,6-tetramethyl-4-[(2,3,4,5,6-pentamethylphenyl)methyl]benzene.
| Compound Name | 1-ethyl-2,3,5,6-tetramethyl-4-[(2,3,4,5,6-pentamethylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 20685020 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-ethyl-2,3,5,6-tetramethyl-4-[(2,3,4,5,6-pentamethylphenyl)methyl]benzene |
| SMILES | CCc1c(C)c(C)c(Cc2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C24H34/c1-11-22-18(7)20(9)24(21(10)19(22)8)12-23-16(5)14(3)13(2)15(4)17(23)6/h11-12H2,1-10H3 |
| InChIKey | FMQCMVMMIJSYJO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |