C13H20O3S — CID 167660292
(3-ethyl-2,4,5,6-tetramethylphenyl)methanesulfonic acid (PubChem CID 167660292) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is (3-ethyl-2,4,5,6-tetramethylphenyl)methanesulfonic acid.
| Compound Name | (3-ethyl-2,4,5,6-tetramethylphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 167660292 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (3-ethyl-2,4,5,6-tetramethylphenyl)methanesulfonic acid |
| SMILES | CCc1c(C)c(C)c(C)c(CS(=O)(=O)O)c1C |
| InChI | InChI=1S/C13H20O3S/c1-6-12-9(3)8(2)10(4)13(11(12)5)7-17(14,15)16/h6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | NZEZENWTPRXQFR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|