About (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane
(2-hydroxy-6-methylphenyl)methanesulfonic acid;octane (PubChem CID 174514147) has the molecular formula C16H28O4S
and a molecular weight of 316.46 g/mol. Its IUPAC name is (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane.
Molecular Properties
| Compound Name | (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane |
| PubChem CID | 174514147 |
| Molecular Formula | C16H28O4S |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane |
| SMILES | CCCCCCCC.Cc1cccc(O)c1CS(=O)(=O)O |
| InChI | InChI=1S/C8H10O4S.C8H18/c1-6-3-2-4-8(9)7(6)5-13(10,11)12;1-3-5-7-8-6-4-2/h2-4,9H,5H2,1H3,(H,10,11,12);3-8H2,1-2H3 |
| InChIKey | JJBPJGOBGQHSLC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane?
The IUPAC name of (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane (CID 174514147) is (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane.
What is the SMILES notation for (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane?
The canonical SMILES for (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane is CCCCCCCC.Cc1cccc(O)c1CS(=O)(=O)O.
What is the InChIKey of (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane?
The InChIKey is JJBPJGOBGQHSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4S.C8H18/c1-6-3-2-4-8(9)7(6)5-13(10,11)12;1-3-5-7-8-6-4-2/h2-4,9H,5H2,1H3,(H,10,11,12);3-8H2,1-2H3.
What are the key properties of (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane?
(2-hydroxy-6-methylphenyl)methanesulfonic acid;octane has a molecular weight of 316.46 g/mol, XLogP of 4.46, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-6-methylphenyl)methanesulfonic acid;octane is sourced from PubChem (CID 174514147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).