C12H18O18S6 — CID 71368160
[2,3,4,5,6-pentakis(sulfomethyl)phenyl]methanesulfonic acid (PubChem CID 71368160) has the molecular formula C12H18O18S6 and a molecular weight of 642.66 g/mol. Its IUPAC name is [2,3,4,5,6-pentakis(sulfomethyl)phenyl]methanesulfonic acid.
| Compound Name | [2,3,4,5,6-pentakis(sulfomethyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 71368160 |
| Molecular Formula | C12H18O18S6 |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 641.88 |
| IUPAC Name | [2,3,4,5,6-pentakis(sulfomethyl)phenyl]methanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1c(CS(=O)(=O)O)c(CS(=O)(=O)O)c(CS(=O)(=O)O)c(CS(=O)(=O)O)c1CS(=O)(=O)O |
| InChI | InChI=1S/C12H18O18S6/c13-31(14,15)1-7-8(2-32(16,17)18)10(4-34(22,23)24)12(6-36(28,29)30)11(5-35(25,26)27)9(7)3-33(19,20)21/h1-6H2,(H,13,14,15)(H,16,17,18)(H,19,20,21)(H,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | ZJUBXXYXDHFVGL-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 326.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|