C9H13NO7S2 — CID 20562308
(2-hydroxy-1,4-dimethyl-5-methylsulfonyl-6-oxo-3-pyridinyl)methanesulfonic acid (PubChem CID 20562308) has the molecular formula C9H13NO7S2 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2-hydroxy-1,4-dimethyl-5-methylsulfonyl-6-oxo-3-pyridinyl)methanesulfonic acid.
| Compound Name | (2-hydroxy-1,4-dimethyl-5-methylsulfonyl-6-oxo-3-pyridinyl)methanesulfonic acid |
|---|---|
| PubChem CID | 20562308 |
| Molecular Formula | C9H13NO7S2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | (2-hydroxy-1,4-dimethyl-5-methylsulfonyl-6-oxo-3-pyridinyl)methanesulfonic acid |
| SMILES | Cc1c(CS(=O)(=O)O)c(O)n(C)c(=O)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H13NO7S2/c1-5-6(4-19(15,16)17)8(11)10(2)9(12)7(5)18(3,13)14/h11H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | GXDVPTHXMBWOGB-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|