C54H70 — CID 149461668
1,2,3,4,5-pentamethyl-6-[[2,4,5-tris[(2,3,4,5,6-pentamethylphenyl)methyl]phenyl]methyl]benzene (PubChem CID 149461668) has the molecular formula C54H70 and a molecular weight of 719.15 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[[2,4,5-tris[(2,3,4,5,6-pentamethylphenyl)methyl]phenyl]methyl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[[2,4,5-tris[(2,3,4,5,6-pentamethylphenyl)methyl]phenyl]methyl]benzene |
|---|---|
| PubChem CID | 149461668 |
| Molecular Formula | C54H70 |
| Molecular Weight | 719.15 g/mol |
| Exact Mass | 718.55 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[[2,4,5-tris[(2,3,4,5,6-pentamethylphenyl)methyl]phenyl]methyl]benzene |
| SMILES | Cc1c(C)c(C)c(Cc2cc(Cc3c(C)c(C)c(C)c(C)c3C)c(Cc3c(C)c(C)c(C)c(C)c3C)cc2Cc2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C54H70/c1-27-31(5)39(13)51(40(14)32(27)6)23-47-21-49(25-53-43(17)35(9)29(3)36(10)44(53)18)50(26-54-45(19)37(11)30(4)38(12)46(54)20)22-48(47)24-52-41(15)33(7)28(2)34(8)42(52)16/h21-22H,23-26H2,1-20H3 |
| InChIKey | YZQBZVBIJIQORI-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.15 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |