C10H16N2 — CID 23346989
5-(aminomethyl)-2,3,4-trimethylaniline (PubChem CID 23346989) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3,4-trimethylaniline.
| Compound Name | 5-(aminomethyl)-2,3,4-trimethylaniline |
|---|---|
| PubChem CID | 23346989 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-(aminomethyl)-2,3,4-trimethylaniline |
| SMILES | Cc1c(N)cc(CN)c(C)c1C |
| InChI | InChI=1S/C10H16N2/c1-6-7(2)9(5-11)4-10(12)8(6)3/h4H,5,11-12H2,1-3H3 |
| InChIKey | WPAVIDDSCRWHFU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|