C11H17N — CID 117276223
(5-ethyl-2,3-dimethylphenyl)methanamine (PubChem CID 117276223) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (5-ethyl-2,3-dimethylphenyl)methanamine.
| Compound Name | (5-ethyl-2,3-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 117276223 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (5-ethyl-2,3-dimethylphenyl)methanamine |
| SMILES | CCc1cc(C)c(C)c(CN)c1 |
| InChI | InChI=1S/C11H17N/c1-4-10-5-8(2)9(3)11(6-10)7-12/h5-6H,4,7,12H2,1-3H3 |
| InChIKey | IAFXACSEQIKUOO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |