C15H23N — CID 117310098
[1-(5-ethyl-2,3-dimethylphenyl)cyclobutyl]methanamine (PubChem CID 117310098) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is [1-(5-ethyl-2,3-dimethylphenyl)cyclobutyl]methanamine.
| Compound Name | [1-(5-ethyl-2,3-dimethylphenyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 117310098 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | [1-(5-ethyl-2,3-dimethylphenyl)cyclobutyl]methanamine |
| SMILES | CCc1cc(C)c(C)c(C2(CN)CCC2)c1 |
| InChI | InChI=1S/C15H23N/c1-4-13-8-11(2)12(3)14(9-13)15(10-16)6-5-7-15/h8-9H,4-7,10,16H2,1-3H3 |
| InChIKey | DTQFXEZPMIJABT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |