C13H20O — CID 117283284
1-(5-ethyl-2,3-dimethylphenyl)propan-2-ol (PubChem CID 117283284) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(5-ethyl-2,3-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(5-ethyl-2,3-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117283284 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-(5-ethyl-2,3-dimethylphenyl)propan-2-ol |
| SMILES | CCc1cc(C)c(C)c(CC(C)O)c1 |
| InChI | InChI=1S/C13H20O/c1-5-12-6-9(2)11(4)13(8-12)7-10(3)14/h6,8,10,14H,5,7H2,1-4H3 |
| InChIKey | NUWMNJQQCTWPME-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |