About ethane;4-ethyl-2,6-dimethylphenol
ethane;4-ethyl-2,6-dimethylphenol (PubChem CID 143343408) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;4-ethyl-2,6-dimethylphenol.
Molecular Properties
| Compound Name | ethane;4-ethyl-2,6-dimethylphenol |
| PubChem CID | 143343408 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | ethane;4-ethyl-2,6-dimethylphenol |
| SMILES | CC.CC.CCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C10H14O.2C2H6/c1-4-9-5-7(2)10(11)8(3)6-9;2*1-2/h5-6,11H,4H2,1-3H3;2*1-2H3 |
| InChIKey | WBHURMZTVFDWLS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethyl-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-2,6-dimethylphenol?
The IUPAC name of ethane;4-ethyl-2,6-dimethylphenol (CID 143343408) is ethane;4-ethyl-2,6-dimethylphenol.
What is the SMILES notation for ethane;4-ethyl-2,6-dimethylphenol?
The canonical SMILES for ethane;4-ethyl-2,6-dimethylphenol is CC.CC.CCc1cc(C)c(O)c(C)c1.
What is the InChIKey of ethane;4-ethyl-2,6-dimethylphenol?
The InChIKey is WBHURMZTVFDWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.2C2H6/c1-4-9-5-7(2)10(11)8(3)6-9;2*1-2/h5-6,11H,4H2,1-3H3;2*1-2H3.
What are the key properties of ethane;4-ethyl-2,6-dimethylphenol?
ethane;4-ethyl-2,6-dimethylphenol has a molecular weight of 210.36 g/mol, XLogP of 4.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-2,6-dimethylphenol is sourced from PubChem (CID 143343408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).