About 4-ethyl-2,6-dimethylphenol;methane
4-ethyl-2,6-dimethylphenol;methane (PubChem CID 159618487) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-ethyl-2,6-dimethylphenol;methane.
Molecular Properties
| Compound Name | 4-ethyl-2,6-dimethylphenol;methane |
| PubChem CID | 159618487 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-ethyl-2,6-dimethylphenol;methane |
| SMILES | C.CCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C10H14O.CH4/c1-4-9-5-7(2)10(11)8(3)6-9;/h5-6,11H,4H2,1-3H3;1H4 |
| InChIKey | MNPAQMSXMFBYNP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2,6-dimethylphenol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6-dimethylphenol;methane?
The IUPAC name of 4-ethyl-2,6-dimethylphenol;methane (CID 159618487) is 4-ethyl-2,6-dimethylphenol;methane.
What is the SMILES notation for 4-ethyl-2,6-dimethylphenol;methane?
The canonical SMILES for 4-ethyl-2,6-dimethylphenol;methane is C.CCc1cc(C)c(O)c(C)c1.
What is the InChIKey of 4-ethyl-2,6-dimethylphenol;methane?
The InChIKey is MNPAQMSXMFBYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.CH4/c1-4-9-5-7(2)10(11)8(3)6-9;/h5-6,11H,4H2,1-3H3;1H4.
What are the key properties of 4-ethyl-2,6-dimethylphenol;methane?
4-ethyl-2,6-dimethylphenol;methane has a molecular weight of 166.26 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6-dimethylphenol;methane is sourced from PubChem (CID 159618487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).