C15H22O2 — CID 117341037
3-(5-ethyl-2,3-dimethylphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117341037) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-(5-ethyl-2,3-dimethylphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-ethyl-2,3-dimethylphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117341037 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-(5-ethyl-2,3-dimethylphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CCc1cc(C)c(C)c(CC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C15H22O2/c1-6-12-7-10(2)11(3)13(8-12)9-15(4,5)14(16)17/h7-8H,6,9H2,1-5H3,(H,16,17) |
| InChIKey | QOJMZUNNVVCWEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |