C13H19NO2 — CID 117316222
2-amino-3-(5-ethyl-2,3-dimethylphenyl)propanoic acid (PubChem CID 117316222) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-amino-3-(5-ethyl-2,3-dimethylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(5-ethyl-2,3-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117316222 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-amino-3-(5-ethyl-2,3-dimethylphenyl)propanoic acid |
| SMILES | CCc1cc(C)c(C)c(CC(N)C(=O)O)c1 |
| InChI | InChI=1S/C13H19NO2/c1-4-10-5-8(2)9(3)11(6-10)7-12(14)13(15)16/h5-6,12H,4,7,14H2,1-3H3,(H,15,16) |
| InChIKey | NDNVIJWGHXBJPI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |