C11H16O2 — CID 117278410
5-(2-hydroxypropyl)-2,3-dimethylphenol (PubChem CID 117278410) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-(2-hydroxypropyl)-2,3-dimethylphenol.
| Compound Name | 5-(2-hydroxypropyl)-2,3-dimethylphenol |
|---|---|
| PubChem CID | 117278410 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 5-(2-hydroxypropyl)-2,3-dimethylphenol |
| SMILES | Cc1cc(CC(C)O)cc(O)c1C |
| InChI | InChI=1S/C11H16O2/c1-7-4-10(5-8(2)12)6-11(13)9(7)3/h4,6,8,12-13H,5H2,1-3H3 |
| InChIKey | DQPXZPGWKAKQEG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |