C10H15NO2 — CID 117278874
5-[(methoxyamino)methyl]-2,3-dimethylphenol (PubChem CID 117278874) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-[(methoxyamino)methyl]-2,3-dimethylphenol.
| Compound Name | 5-[(methoxyamino)methyl]-2,3-dimethylphenol |
|---|---|
| PubChem CID | 117278874 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5-[(methoxyamino)methyl]-2,3-dimethylphenol |
| SMILES | CONCc1cc(C)c(C)c(O)c1 |
| InChI | InChI=1S/C10H15NO2/c1-7-4-9(6-11-13-3)5-10(12)8(7)2/h4-5,11-12H,6H2,1-3H3 |
| InChIKey | YGWMBTNTUQIUTQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|