C11H17NO3 — CID 117301699
2-methoxy-3-[(methoxyamino)methyl]-5,6-dimethylphenol (PubChem CID 117301699) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-methoxy-3-[(methoxyamino)methyl]-5,6-dimethylphenol.
| Compound Name | 2-methoxy-3-[(methoxyamino)methyl]-5,6-dimethylphenol |
|---|---|
| PubChem CID | 117301699 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-methoxy-3-[(methoxyamino)methyl]-5,6-dimethylphenol |
| SMILES | CONCc1cc(C)c(C)c(O)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-7-5-9(6-12-15-4)11(14-3)10(13)8(7)2/h5,12-13H,6H2,1-4H3 |
| InChIKey | JANLLAACEOLXHI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|