About 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride
5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride (PubChem CID 91937662) has the molecular formula C8H12ClNO4
and a molecular weight of 221.64 g/mol. Its IUPAC name is 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride.
Molecular Properties
| Compound Name | 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride |
| PubChem CID | 91937662 |
| Molecular Formula | C8H12ClNO4 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride |
| SMILES | CONCc1cc(O)c(O)cc1O.Cl |
| InChI | InChI=1S/C8H11NO4.ClH/c1-13-9-4-5-2-7(11)8(12)3-6(5)10;/h2-3,9-12H,4H2,1H3;1H |
| InChIKey | SEOHMCZOBRSGAR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride?
The IUPAC name of 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride (CID 91937662) is 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride.
What is the SMILES notation for 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride?
The canonical SMILES for 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride is CONCc1cc(O)c(O)cc1O.Cl.
What is the InChIKey of 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride?
The InChIKey is SEOHMCZOBRSGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4.ClH/c1-13-9-4-5-2-7(11)8(12)3-6(5)10;/h2-3,9-12H,4H2,1H3;1H.
What are the key properties of 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride?
5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride has a molecular weight of 221.64 g/mol, XLogP of 0.88, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(methoxyamino)methyl]benzene-1,2,4-triol;hydrochloride is sourced from PubChem (CID 91937662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).