C8H9F2NO3 — CID 117293074
4,6-difluoro-5-[(methoxyamino)methyl]benzene-1,3-diol (PubChem CID 117293074) has the molecular formula C8H9F2NO3 and a molecular weight of 205.16 g/mol. Its IUPAC name is 4,6-difluoro-5-[(methoxyamino)methyl]benzene-1,3-diol.
| Compound Name | 4,6-difluoro-5-[(methoxyamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 117293074 |
| Molecular Formula | C8H9F2NO3 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4,6-difluoro-5-[(methoxyamino)methyl]benzene-1,3-diol |
| SMILES | CONCc1c(F)c(O)cc(O)c1F |
| InChI | InChI=1S/C8H9F2NO3/c1-14-11-3-4-7(9)5(12)2-6(13)8(4)10/h2,11-13H,3H2,1H3 |
| InChIKey | VFFZSCOOSNTHQP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|