C12H20N2O — CID 117107457
5-[(methoxyamino)methyl]-N,N,2,3-tetramethylaniline (PubChem CID 117107457) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-[(methoxyamino)methyl]-N,N,2,3-tetramethylaniline.
| Compound Name | 5-[(methoxyamino)methyl]-N,N,2,3-tetramethylaniline |
|---|---|
| PubChem CID | 117107457 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-[(methoxyamino)methyl]-N,N,2,3-tetramethylaniline |
| SMILES | CONCc1cc(C)c(C)c(N(C)C)c1 |
| InChI | InChI=1S/C12H20N2O/c1-9-6-11(8-13-15-5)7-12(10(9)2)14(3)4/h6-7,13H,8H2,1-5H3 |
| InChIKey | LFAPNKCAOHQIKK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|