C10H15NO — CID 60702400
1-(3,5-dimethylphenyl)-N-methoxymethanamine (PubChem CID 60702400) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 60702400 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-methoxymethanamine |
| SMILES | CONCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H15NO/c1-8-4-9(2)6-10(5-8)7-11-12-3/h4-6,11H,7H2,1-3H3 |
| InChIKey | TWEGVXMNRSDSDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|