C8H8BrF2NO — CID 117383021
1-(3-bromo-4,5-difluorophenyl)-N-methoxymethanamine (PubChem CID 117383021) has the molecular formula C8H8BrF2NO and a molecular weight of 252.06 g/mol. Its IUPAC name is 1-(3-bromo-4,5-difluorophenyl)-N-methoxymethanamine.
| Compound Name | 1-(3-bromo-4,5-difluorophenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117383021 |
| Molecular Formula | C8H8BrF2NO |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 1-(3-bromo-4,5-difluorophenyl)-N-methoxymethanamine |
| SMILES | CONCc1cc(F)c(F)c(Br)c1 |
| InChI | InChI=1S/C8H8BrF2NO/c1-13-12-4-5-2-6(9)8(11)7(10)3-5/h2-3,12H,4H2,1H3 |
| InChIKey | MPXGYBTXLPNSGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|