About 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol
4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol (PubChem CID 114155638) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol |
| PubChem CID | 114155638 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol |
| SMILES | COCC(CO)NCc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C13H21NO3/c1-9-4-11(5-10(2)13(9)16)6-14-12(7-15)8-17-3/h4-5,12,14-16H,6-8H2,1-3H3 |
| InChIKey | MVFAUWPMTYFHGF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol?
The IUPAC name of 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol (CID 114155638) is 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol is COCC(CO)NCc1cc(C)c(O)c(C)c1.
What is the InChIKey of 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol?
The InChIKey is MVFAUWPMTYFHGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-9-4-11(5-10(2)13(9)16)6-14-12(7-15)8-17-3/h4-5,12,14-16H,6-8H2,1-3H3.
What are the key properties of 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol?
4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol has a molecular weight of 239.31 g/mol, XLogP of 1.11, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1-hydroxy-3-methoxypropan-2-yl)amino]methyl]-2,6-dimethylphenol is sourced from PubChem (CID 114155638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).