C13H21NO2 — CID 106187895
2-[(2,6-dimethylphenyl)methylamino]-3-methoxypropan-1-ol (PubChem CID 106187895) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)methylamino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(2,6-dimethylphenyl)methylamino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106187895 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)methylamino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)NCc1c(C)cccc1C |
| InChI | InChI=1S/C13H21NO2/c1-10-5-4-6-11(2)13(10)7-14-12(8-15)9-16-3/h4-6,12,14-15H,7-9H2,1-3H3 |
| InChIKey | NVTJAQGMGUKDGW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |