C11H20N2O2 — CID 106187879
2-[(1-ethylpyrrol-2-yl)methylamino]-3-methoxypropan-1-ol (PubChem CID 106187879) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(1-ethylpyrrol-2-yl)methylamino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(1-ethylpyrrol-2-yl)methylamino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106187879 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[(1-ethylpyrrol-2-yl)methylamino]-3-methoxypropan-1-ol |
| SMILES | CCn1cccc1CNC(CO)COC |
| InChI | InChI=1S/C11H20N2O2/c1-3-13-6-4-5-11(13)7-12-10(8-14)9-15-2/h4-6,10,12,14H,3,7-9H2,1-2H3 |
| InChIKey | PHEBYHSUNRAJJL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |