C13H19F2NO4 — CID 106187407
2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methoxypropan-1-ol (PubChem CID 106187407) has the molecular formula C13H19F2NO4 and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methoxypropan-1-ol.
| Compound Name | 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106187407 |
| Molecular Formula | C13H19F2NO4 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)NCc1cccc(OC)c1OC(F)F |
| InChI | InChI=1S/C13H19F2NO4/c1-18-8-10(7-17)16-6-9-4-3-5-11(19-2)12(9)20-13(14)15/h3-5,10,13,16-17H,6-8H2,1-2H3 |
| InChIKey | PNSXOOCJMQHJOS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |