C13H18F2N2O4 — CID 106235526
2-[2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]ethoxy]acetamide (PubChem CID 106235526) has the molecular formula C13H18F2N2O4 and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106235526 |
| Molecular Formula | C13H18F2N2O4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]ethoxy]acetamide |
| SMILES | COc1cccc(CNCCOCC(N)=O)c1OC(F)F |
| InChI | InChI=1S/C13H18F2N2O4/c1-19-10-4-2-3-9(12(10)21-13(14)15)7-17-5-6-20-8-11(16)18/h2-4,13,17H,5-8H2,1H3,(H2,16,18) |
| InChIKey | FAKKDVBVVGUZOW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|