C14H19F2NO4 — CID 43726123
methyl 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-methylpropanoate (PubChem CID 43726123) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 43726123 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl 2-[[2-(difluoromethoxy)-3-methoxyphenyl]methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NCc1cccc(OC)c1OC(F)F |
| InChI | InChI=1S/C14H19F2NO4/c1-14(2,12(18)20-4)17-8-9-6-5-7-10(19-3)11(9)21-13(15)16/h5-7,13,17H,8H2,1-4H3 |
| InChIKey | VWIIJUJBUZRZNB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |