C15H23NO4 — CID 63057770
methyl 2-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]acetate (PubChem CID 63057770) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl 2-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 63057770 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl 2-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(CNC(C)(C)C)cccc1OC |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)16-9-11-7-6-8-12(18-4)14(11)20-10-13(17)19-5/h6-8,16H,9-10H2,1-5H3 |
| InChIKey | TWDKIUMSXVXNAR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |