C16H27NO4 — CID 63929615
1-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]-3-methoxypropan-2-ol (PubChem CID 63929615) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]-3-methoxypropan-2-ol.
| Compound Name | 1-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 63929615 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-[2-[(tert-butylamino)methyl]-6-methoxyphenoxy]-3-methoxypropan-2-ol |
| SMILES | COCC(O)COc1c(CNC(C)(C)C)cccc1OC |
| InChI | InChI=1S/C16H27NO4/c1-16(2,3)17-9-12-7-6-8-14(20-5)15(12)21-11-13(18)10-19-4/h6-8,13,17-18H,9-11H2,1-5H3 |
| InChIKey | BIQYGRYDQJNDFO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |