C9H14N2 — CID 67923702
5-ethyl-3-methylbenzene-1,2-diamine (PubChem CID 67923702) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-ethyl-3-methylbenzene-1,2-diamine.
| Compound Name | 5-ethyl-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 67923702 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-ethyl-3-methylbenzene-1,2-diamine |
| SMILES | CCc1cc(C)c(N)c(N)c1 |
| InChI | InChI=1S/C9H14N2/c1-3-7-4-6(2)9(11)8(10)5-7/h4-5H,3,10-11H2,1-2H3 |
| InChIKey | MAGTUHYCZAICOI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|