C7H10N2O2 — CID 154288362
4-amino-6-(aminomethyl)benzene-1,3-diol (PubChem CID 154288362) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-amino-6-(aminomethyl)benzene-1,3-diol.
| Compound Name | 4-amino-6-(aminomethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 154288362 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 4-amino-6-(aminomethyl)benzene-1,3-diol |
| SMILES | NCc1cc(N)c(O)cc1O |
| InChI | InChI=1S/C7H10N2O2/c8-3-4-1-5(9)7(11)2-6(4)10/h1-2,10-11H,3,8-9H2 |
| InChIKey | DPOLNXLISPBIPO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|