C12H17NaS — CID 59908163
sodium (2,3,4,5,6-pentamethylphenyl)methanethiolate (PubChem CID 59908163) has the molecular formula C12H17NaS and a molecular weight of 216.32 g/mol. Its IUPAC name is sodium (2,3,4,5,6-pentamethylphenyl)methanethiolate.
| Compound Name | sodium (2,3,4,5,6-pentamethylphenyl)methanethiolate |
|---|---|
| PubChem CID | 59908163 |
| Molecular Formula | C12H17NaS |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | sodium (2,3,4,5,6-pentamethylphenyl)methanethiolate |
| SMILES | Cc1c(C)c(C)c(C[S-])c(C)c1C.[Na+] |
| InChI | InChI=1S/C12H18S.Na/c1-7-8(2)10(4)12(6-13)11(5)9(7)3;/h13H,6H2,1-5H3;/q;+1/p-1 |
| InChIKey | KBSVWDIBVYADLD-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|