C14H20Cl2 — CID 91872066
1,4-bis(2-chloroethyl)-2,3,5,6-tetramethylbenzene (PubChem CID 91872066) has the molecular formula C14H20Cl2 and a molecular weight of 259.22 g/mol. Its IUPAC name is 1,4-bis(2-chloroethyl)-2,3,5,6-tetramethylbenzene.
| Compound Name | 1,4-bis(2-chloroethyl)-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 91872066 |
| Molecular Formula | C14H20Cl2 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,4-bis(2-chloroethyl)-2,3,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(CCCl)c(C)c(C)c1CCCl |
| InChI | InChI=1S/C14H20Cl2/c1-9-10(2)14(6-8-16)12(4)11(3)13(9)5-7-15/h5-8H2,1-4H3 |
| InChIKey | IPNWJPDIIVEARW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|