C7H12Cl2N2 — CID 131860379
4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole;hydrochloride (PubChem CID 131860379) has the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. Its IUPAC name is 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole;hydrochloride.
| Compound Name | 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole;hydrochloride |
|---|---|
| PubChem CID | 131860379 |
| Molecular Formula | C7H12Cl2N2 |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1CCCl.Cl |
| InChI | InChI=1S/C7H11ClN2.ClH/c1-5-7(3-4-8)6(2)10-9-5;/h3-4H2,1-2H3,(H,9,10);1H |
| InChIKey | OWPLCTFPVLDJMZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|