C5H9Cl2N3 — CID 146155711
3-(2-chloroethyl)-5-methyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 146155711) has the molecular formula C5H9Cl2N3 and a molecular weight of 182.05 g/mol. Its IUPAC name is 3-(2-chloroethyl)-5-methyl-1H-1,2,4-triazole;hydrochloride.
| Compound Name | 3-(2-chloroethyl)-5-methyl-1H-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 146155711 |
| Molecular Formula | C5H9Cl2N3 |
| Molecular Weight | 182.05 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 3-(2-chloroethyl)-5-methyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | Cc1nc(CCCl)n[nH]1.Cl |
| InChI | InChI=1S/C5H8ClN3.ClH/c1-4-7-5(2-3-6)9-8-4;/h2-3H2,1H3,(H,7,8,9);1H |
| InChIKey | AAPNMZFKSWCBNO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.05 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|