C5H8ClN3 — CID 45492456
3-chloro-5-propan-2-yl-1H-1,2,4-triazole (PubChem CID 45492456) has the molecular formula C5H8ClN3 and a molecular weight of 145.59 g/mol. Its IUPAC name is 3-chloro-5-propan-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-chloro-5-propan-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 45492456 |
| Molecular Formula | C5H8ClN3 |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 3-chloro-5-propan-2-yl-1H-1,2,4-triazole |
| SMILES | CC(C)c1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C5H8ClN3/c1-3(2)4-7-5(6)9-8-4/h3H,1-2H3,(H,7,8,9) |
| InChIKey | JDIJNDYVYVYVND-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |