About 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride
3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 54593423) has the molecular formula C5H10ClN3
and a molecular weight of 147.61 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride |
| PubChem CID | 54593423 |
| Molecular Formula | C5H10ClN3 |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | CCc1n[nH]c(C)n1.Cl |
| InChI | InChI=1S/C5H9N3.ClH/c1-3-5-6-4(2)7-8-5;/h3H2,1-2H3,(H,6,7,8);1H |
| InChIKey | XKFNTSVSEQAMEF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride?
The IUPAC name of 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride (CID 54593423) is 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride?
The canonical SMILES for 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride is CCc1n[nH]c(C)n1.Cl.
What is the InChIKey of 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride?
The InChIKey is XKFNTSVSEQAMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.ClH/c1-3-5-6-4(2)7-8-5;/h3H2,1-2H3,(H,6,7,8);1H.
What are the key properties of 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride?
3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride has a molecular weight of 147.61 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 54593423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).