C5H10ClN3 — CID 54593423
3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 54593423) has the molecular formula C5H10ClN3 and a molecular weight of 147.61 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride.
| Compound Name | 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 54593423 |
| Molecular Formula | C5H10ClN3 |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 3-ethyl-5-methyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | CCc1n[nH]c(C)n1.Cl |
| InChI | InChI=1S/C5H9N3.ClH/c1-3-5-6-4(2)7-8-5;/h3H2,1-2H3,(H,6,7,8);1H |
| InChIKey | XKFNTSVSEQAMEF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |