C7H13Cl2N3 — CID 119032045
3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride (PubChem CID 119032045) has the molecular formula C7H13Cl2N3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride.
| Compound Name | 3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 119032045 |
| Molecular Formula | C7H13Cl2N3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-tert-butyl-5-(chloromethyl)-1H-1,2,4-triazole;hydrochloride |
| SMILES | CC(C)(C)c1n[nH]c(CCl)n1.Cl |
| InChI | InChI=1S/C7H12ClN3.ClH/c1-7(2,3)6-9-5(4-8)10-11-6;/h4H2,1-3H3,(H,9,10,11);1H |
| InChIKey | YEQLIHFCCLMOIK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|