C16H22Cl2N2O — CID 163332805
4-[5-(3-chlorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole;hydrochloride (PubChem CID 163332805) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 4-[5-(3-chlorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole;hydrochloride.
| Compound Name | 4-[5-(3-chlorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole;hydrochloride |
|---|---|
| PubChem CID | 163332805 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[5-(3-chlorophenoxy)pentyl]-3,5-dimethyl-1H-pyrazole;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1CCCCCOc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C16H21ClN2O.ClH/c1-12-16(13(2)19-18-12)9-4-3-5-10-20-15-8-6-7-14(17)11-15;/h6-8,11H,3-5,9-10H2,1-2H3,(H,18,19);1H |
| InChIKey | SJGUUGFRRNPSAW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|